C15H21F3O — CID 123221838
3-ethylidene-1,1,1-trifluoro-2,5,6-trimethyldeca-4,6,8-trien-2-ol (PubChem CID 123221838) has the molecular formula C15H21F3O and a molecular weight of 274.33 g/mol. Its IUPAC name is 3-ethylidene-1,1,1-trifluoro-2,5,6-trimethyldeca-4,6,8-trien-2-ol.
| Compound Name | 3-ethylidene-1,1,1-trifluoro-2,5,6-trimethyldeca-4,6,8-trien-2-ol |
|---|---|
| PubChem CID | 123221838 |
| Molecular Formula | C15H21F3O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-ethylidene-1,1,1-trifluoro-2,5,6-trimethyldeca-4,6,8-trien-2-ol |
| SMILES | CC=CC=C(C)C(C)=CC(=CC)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C15H21F3O/c1-6-8-9-11(3)12(4)10-13(7-2)14(5,19)15(16,17)18/h6-10,19H,1-5H3 |
| InChIKey | PMIGZRLCRZVQJR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|