C14H14ClNO4S — CID 1232220
(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1232220) has the molecular formula C14H14ClNO4S and a molecular weight of 327.79 g/mol. Its IUPAC name is (5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1232220 |
| Molecular Formula | C14H14ClNO4S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | (5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/SC(=O)NC2=O)cc(Cl)c1OCC |
| InChI | InChI=1S/C14H14ClNO4S/c1-3-19-10-6-8(5-9(15)12(10)20-4-2)7-11-13(17)16-14(18)21-11/h5-7H,3-4H2,1-2H3,(H,16,17,18)/b11-7+ |
| InChIKey | UVQGRBYLOZYDPG-YRNVUSSQSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|