C24H32F6O6 — CID 123222190
1,1,1,3,3,3-hexafluoropropan-2-yl 6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate (PubChem CID 123222190) has the molecular formula C24H32F6O6 and a molecular weight of 530.50 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate |
|---|---|
| PubChem CID | 123222190 |
| Molecular Formula | C24H32F6O6 |
| Molecular Weight | 530.50 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 6-oxo-3-(2,4,4-trimethyl-2-propan-2-ylpentanoyl)oxy-5-oxatricyclo[5.2.1.04,8]decane-7-carboxylate |
| SMILES | CC(C)C(C)(CC(C)(C)C)C(=O)OC1CC2CC3C1OC(=O)C3(C(=O)OC(C(F)(F)F)C(F)(F)F)C2 |
| InChI | InChI=1S/C24H32F6O6/c1-11(2)21(6,10-20(3,4)5)17(31)34-14-8-12-7-13-15(14)35-18(32)22(13,9-12)19(33)36-16(23(25,26)27)24(28,29)30/h11-16H,7-10H2,1-6H3 |
| InChIKey | VIKIVBZNMVJMNR-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|