C19H37N — CID 123222259
N-ethyl-N,2,4,5-tetramethyl-3-(1-methylcyclobutyl)oct-5-en-1-amine (PubChem CID 123222259) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is N-ethyl-N,2,4,5-tetramethyl-3-(1-methylcyclobutyl)oct-5-en-1-amine.
| Compound Name | N-ethyl-N,2,4,5-tetramethyl-3-(1-methylcyclobutyl)oct-5-en-1-amine |
|---|---|
| PubChem CID | 123222259 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | N-ethyl-N,2,4,5-tetramethyl-3-(1-methylcyclobutyl)oct-5-en-1-amine |
| SMILES | CCC=C(C)C(C)C(C(C)CN(C)CC)C1(C)CCC1 |
| InChI | InChI=1S/C19H37N/c1-8-11-15(3)17(5)18(19(6)12-10-13-19)16(4)14-20(7)9-2/h11,16-18H,8-10,12-14H2,1-7H3 |
| InChIKey | NZLCURUIKVVHDI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|