C13H19F3N2O — CID 123222641
2,2,2-trifluoro-N-(2-methylidene-4-piperidin-4-ylpent-3-enyl)acetamide (PubChem CID 123222641) has the molecular formula C13H19F3N2O and a molecular weight of 276.30 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(2-methylidene-4-piperidin-4-ylpent-3-enyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(2-methylidene-4-piperidin-4-ylpent-3-enyl)acetamide |
|---|---|
| PubChem CID | 123222641 |
| Molecular Formula | C13H19F3N2O |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2,2,2-trifluoro-N-(2-methylidene-4-piperidin-4-ylpent-3-enyl)acetamide |
| SMILES | C=C(C=C(C)C1CCNCC1)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H19F3N2O/c1-9(8-18-12(19)13(14,15)16)7-10(2)11-3-5-17-6-4-11/h7,11,17H,1,3-6,8H2,2H3,(H,18,19) |
| InChIKey | JCBVRCJXLWVJGU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|