C37H26N6O3 — CID 123223103
3-methyl-7-[3-(3-methyl-2-oxo-1,5-dihydropyrido[3,2-b]indol-4-yl)-5-(1,2-oxazol-5-yl)phenyl]-4-(1H-pyrrol-3-yl)-1,5-dihydropyrido[3,2-b]indol-2-one (PubChem CID 123223103) has the molecular formula C37H26N6O3 and a molecular weight of 602.65 g/mol. Its IUPAC name is 3-methyl-7-[3-(3-methyl-2-oxo-1,5-dihydropyrido[3,2-b]indol-4-yl)-5-(1,2-oxazol-5-yl)phenyl]-4-(1H-pyrrol-3-yl)-1,5-dihydropyrido[3,2-b]indol-2-one.
| Compound Name | 3-methyl-7-[3-(3-methyl-2-oxo-1,5-dihydropyrido[3,2-b]indol-4-yl)-5-(1,2-oxazol-5-yl)phenyl]-4-(1H-pyrrol-3-yl)-1,5-dihydropyrido[3,2-b]indol-2-one |
|---|---|
| PubChem CID | 123223103 |
| Molecular Formula | C37H26N6O3 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.21 |
| IUPAC Name | 3-methyl-7-[3-(3-methyl-2-oxo-1,5-dihydropyrido[3,2-b]indol-4-yl)-5-(1,2-oxazol-5-yl)phenyl]-4-(1H-pyrrol-3-yl)-1,5-dihydropyrido[3,2-b]indol-2-one |
| SMILES | Cc1c(-c2cc(-c3ccc4c(c3)[nH]c3c(-c5cc[nH]c5)c(C)c(=O)[nH]c34)cc(-c3ccno3)c2)c2[nH]c3ccccc3c2[nH]c1=O |
| InChI | InChI=1S/C37H26N6O3/c1-18-30(21-9-11-38-17-21)34-33(43-36(18)44)26-8-7-20(16-28(26)41-34)22-13-23(29-10-12-39-46-29)15-24(14-22)31-19(2)37(45)42-32-25-5-3-4-6-27(25)40-35(31)32/h3-17,38,40-41H,1-2H3,(H,42,45)(H,43,44) |
| InChIKey | MXMRQSAJYLTGOA-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 139.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |