About 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane
1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane (PubChem CID 123223182) has the molecular formula C14H28
and a molecular weight of 196.38 g/mol. Its IUPAC name is 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane.
Molecular Properties
| Compound Name | 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane |
| PubChem CID | 123223182 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane |
| SMILES | CC(C)CCC(C)C(C)C1C(C)C1C |
| InChI | InChI=1S/C14H28/c1-9(2)7-8-10(3)11(4)14-12(5)13(14)6/h9-14H,7-8H2,1-6H3 |
| InChIKey | NGEYROOWVXQPRD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane?
The IUPAC name of 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane (CID 123223182) is 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane.
What is the SMILES notation for 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane?
The canonical SMILES for 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane is CC(C)CCC(C)C(C)C1C(C)C1C.
What is the InChIKey of 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane?
The InChIKey is NGEYROOWVXQPRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28/c1-9(2)7-8-10(3)11(4)14-12(5)13(14)6/h9-14H,7-8H2,1-6H3.
What are the key properties of 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane?
1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane has a molecular weight of 196.38 g/mol, XLogP of 4.60, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dimethylheptan-2-yl)-2,3-dimethylcyclopropane is sourced from PubChem (CID 123223182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).