C16H31NO3Si — CID 123223189
4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-amine (PubChem CID 123223189) has the molecular formula C16H31NO3Si and a molecular weight of 313.51 g/mol. Its IUPAC name is 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-amine.
| Compound Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-amine |
|---|---|
| PubChem CID | 123223189 |
| Molecular Formula | C16H31NO3Si |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.21 |
| IUPAC Name | 4-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-amine |
| SMILES | CC1(C)OC2C(CCO[Si](C)(C)C(C)(C)C)=CC(N)C2O1 |
| InChI | InChI=1S/C16H31NO3Si/c1-15(2,3)21(6,7)18-9-8-11-10-12(17)14-13(11)19-16(4,5)20-14/h10,12-14H,8-9,17H2,1-7H3 |
| InChIKey | DASJUZNCLBPJHD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|