C17H31N5 — CID 123223208
13,13-dimethyl-1,5,10,15,17-pentazapentacyclo[10.7.1.02,7.08,20.014,19]icosane (PubChem CID 123223208) has the molecular formula C17H31N5 and a molecular weight of 305.47 g/mol. Its IUPAC name is 13,13-dimethyl-1,5,10,15,17-pentazapentacyclo[10.7.1.02,7.08,20.014,19]icosane.
| Compound Name | 13,13-dimethyl-1,5,10,15,17-pentazapentacyclo[10.7.1.02,7.08,20.014,19]icosane |
|---|---|
| PubChem CID | 123223208 |
| Molecular Formula | C17H31N5 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.26 |
| IUPAC Name | 13,13-dimethyl-1,5,10,15,17-pentazapentacyclo[10.7.1.02,7.08,20.014,19]icosane |
| SMILES | CC1(C)C2CNCC3C4CNCCC4N(C4CNCNC41)C32 |
| InChI | InChI=1S/C17H31N5/c1-17(2)12-7-19-6-11-10-5-18-4-3-13(10)22(15(11)12)14-8-20-9-21-16(14)17/h10-16,18-21H,3-9H2,1-2H3 |
| InChIKey | YHNTVQKIGXKKRJ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 51.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |