C27H39F3N6O7S — CID 123223277
[(4-methoxy-2,5,6-trimethylcyclohexa-1,3-dien-1-yl)sulfonyl-[[5-[4-[(1-methylpiperidin-4-yl)methyl]piperazine-1-carbonyl]-1,3,4-oxadiazol-2-yl]methyl]amino] 2,2,2-trifluoroacetate (PubChem CID 123223277) has the molecular formula C27H39F3N6O7S and a molecular weight of 648.71 g/mol. Its IUPAC name is [(4-methoxy-2,5,6-trimethylcyclohexa-1,3-dien-1-yl)sulfonyl-[[5-[4-[(1-methylpiperidin-4-yl)methyl]piperazine-1-carbonyl]-1,3,4-oxadiazol-2-yl]methyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [(4-methoxy-2,5,6-trimethylcyclohexa-1,3-dien-1-yl)sulfonyl-[[5-[4-[(1-methylpiperidin-4-yl)methyl]piperazine-1-carbonyl]-1,3,4-oxadiazol-2-yl]methyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 123223277 |
| Molecular Formula | C27H39F3N6O7S |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | [(4-methoxy-2,5,6-trimethylcyclohexa-1,3-dien-1-yl)sulfonyl-[[5-[4-[(1-methylpiperidin-4-yl)methyl]piperazine-1-carbonyl]-1,3,4-oxadiazol-2-yl]methyl]amino] 2,2,2-trifluoroacetate |
| SMILES | COC1=CC(C)=C(S(=O)(=O)N(Cc2nnc(C(=O)N3CCN(CC4CCN(C)CC4)CC3)o2)OC(=O)C(F)(F)F)C(C)C1C |
| InChI | InChI=1S/C27H39F3N6O7S/c1-17-14-21(41-5)18(2)19(3)23(17)44(39,40)36(43-26(38)27(28,29)30)16-22-31-32-24(42-22)25(37)35-12-10-34(11-13-35)15-20-6-8-33(4)9-7-20/h14,18-20H,6-13,15-16H2,1-5H3 |
| InChIKey | UMOSTYDZRKRPJC-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 138.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|