C34H55N5O7S — CID 123223593
N-[1-cyclopropyl-3,4-dioxo-4-(prop-2-enylamino)butan-2-yl]-1-[2-[[1-(1,1-dioxothian-2-yl)cyclohexyl]carbamoylamino]-3,3-dimethylbutanoyl]-3,3-dimethylazetidine-2-carboxamide (PubChem CID 123223593) has the molecular formula C34H55N5O7S and a molecular weight of 677.91 g/mol. Its IUPAC name is N-[1-cyclopropyl-3,4-dioxo-4-(prop-2-enylamino)butan-2-yl]-1-[2-[[1-(1,1-dioxothian-2-yl)cyclohexyl]carbamoylamino]-3,3-dimethylbutanoyl]-3,3-dimethylazetidine-2-carboxamide.
| Compound Name | N-[1-cyclopropyl-3,4-dioxo-4-(prop-2-enylamino)butan-2-yl]-1-[2-[[1-(1,1-dioxothian-2-yl)cyclohexyl]carbamoylamino]-3,3-dimethylbutanoyl]-3,3-dimethylazetidine-2-carboxamide |
|---|---|
| PubChem CID | 123223593 |
| Molecular Formula | C34H55N5O7S |
| Molecular Weight | 677.91 g/mol |
| Exact Mass | 677.38 |
| IUPAC Name | N-[1-cyclopropyl-3,4-dioxo-4-(prop-2-enylamino)butan-2-yl]-1-[2-[[1-(1,1-dioxothian-2-yl)cyclohexyl]carbamoylamino]-3,3-dimethylbutanoyl]-3,3-dimethylazetidine-2-carboxamide |
| SMILES | C=CCNC(=O)C(=O)C(CC1CC1)NC(=O)C1N(C(=O)C(NC(=O)NC2(C3CCCCS3(=O)=O)CCCCC2)C(C)(C)C)CC1(C)C |
| InChI | InChI=1S/C34H55N5O7S/c1-7-18-35-28(41)25(40)23(20-22-14-15-22)36-29(42)27-33(5,6)21-39(27)30(43)26(32(2,3)4)37-31(44)38-34(16-10-8-11-17-34)24-13-9-12-19-47(24,45)46/h7,22-24,26-27H,1,8-21H2,2-6H3,(H,35,41)(H,36,42)(H2,37,38,44) |
| InChIKey | BVUKGNAZTKVFPC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 170.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.91 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|