C10H14N2O — CID 123223883
(4-amino-3,4-dihydro-2H-quinolin-1-yl)methanol (PubChem CID 123223883) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is (4-amino-3,4-dihydro-2H-quinolin-1-yl)methanol.
| Compound Name | (4-amino-3,4-dihydro-2H-quinolin-1-yl)methanol |
|---|---|
| PubChem CID | 123223883 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | (4-amino-3,4-dihydro-2H-quinolin-1-yl)methanol |
| SMILES | NC1CCN(CO)c2ccccc21 |
| InChI | InChI=1S/C10H14N2O/c11-9-5-6-12(7-13)10-4-2-1-3-8(9)10/h1-4,9,13H,5-7,11H2 |
| InChIKey | XWBVDMXLDRQPQU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |