C14H23NO3 — CID 123223918
4-[3-(4-methoxyhexa-1,3,5-trien-3-yloxy)propyl]morpholine (PubChem CID 123223918) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 4-[3-(4-methoxyhexa-1,3,5-trien-3-yloxy)propyl]morpholine.
| Compound Name | 4-[3-(4-methoxyhexa-1,3,5-trien-3-yloxy)propyl]morpholine |
|---|---|
| PubChem CID | 123223918 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 4-[3-(4-methoxyhexa-1,3,5-trien-3-yloxy)propyl]morpholine |
| SMILES | C=CC(OC)=C(C=C)OCCCN1CCOCC1 |
| InChI | InChI=1S/C14H23NO3/c1-4-13(16-3)14(5-2)18-10-6-7-15-8-11-17-12-9-15/h4-5H,1-2,6-12H2,3H3 |
| InChIKey | SJJGSZPQDJIMEG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|