About N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine
N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine (PubChem CID 123224062) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine.
Molecular Properties
| Compound Name | N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine |
| PubChem CID | 123224062 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine |
| SMILES | C=CC(CC=CC1C=CC=CC1)/N=C/CC |
| InChI | InChI=1S/C15H21N/c1-3-13-16-15(4-2)12-8-11-14-9-6-5-7-10-14/h4-9,11,13-15H,2-3,10,12H2,1H3/b11-8?,16-13+ |
| InChIKey | SUKUXEWKIQYGFE-JDVSZHNISA-N |
| XLogP | 4.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine?
The IUPAC name of N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine (CID 123224062) is N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine.
What is the SMILES notation for N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine?
The canonical SMILES for N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine is C=CC(CC=CC1C=CC=CC1)/N=C/CC.
What is the InChIKey of N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine?
The InChIKey is SUKUXEWKIQYGFE-JDVSZHNISA-N. The full InChI is InChI=1S/C15H21N/c1-3-13-16-15(4-2)12-8-11-14-9-6-5-7-10-14/h4-9,11,13-15H,2-3,10,12H2,1H3/b11-8?,16-13+.
What are the key properties of N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine?
N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine has a molecular weight of 215.34 g/mol, XLogP of 4.10, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine is sourced from PubChem (CID 123224062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).