C15H21N — CID 123224062
N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine (PubChem CID 123224062) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine.
| Compound Name | N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine |
|---|---|
| PubChem CID | 123224062 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | N-(6-cyclohexa-2,4-dien-1-ylhexa-1,5-dien-3-yl)propan-1-imine |
| SMILES | C=CC(CC=CC1C=CC=CC1)/N=C/CC |
| InChI | InChI=1S/C15H21N/c1-3-13-16-15(4-2)12-8-11-14-9-6-5-7-10-14/h4-9,11,13-15H,2-3,10,12H2,1H3/b11-8?,16-13+ |
| InChIKey | SUKUXEWKIQYGFE-JDVSZHNISA-N |
| XLogP | 4.10 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|