About 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane
2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane (PubChem CID 123224212) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane.
Molecular Properties
| Compound Name | 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane |
| PubChem CID | 123224212 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane |
| SMILES | C=CC(C)(CC)CC(C)(C)C1CO1 |
| InChI | InChI=1S/C12H22O/c1-6-12(5,7-2)9-11(3,4)10-8-13-10/h6,10H,1,7-9H2,2-5H3 |
| InChIKey | YIJSKQCZPWEJHJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane?
The IUPAC name of 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane (CID 123224212) is 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane.
What is the SMILES notation for 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane?
The canonical SMILES for 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane is C=CC(C)(CC)CC(C)(C)C1CO1.
What is the InChIKey of 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane?
The InChIKey is YIJSKQCZPWEJHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O/c1-6-12(5,7-2)9-11(3,4)10-8-13-10/h6,10H,1,7-9H2,2-5H3.
What are the key properties of 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane?
2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane has a molecular weight of 182.31 g/mol, XLogP of 3.40, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethyl-2,4-dimethylhex-5-en-2-yl)oxirane is sourced from PubChem (CID 123224212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).