About 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane
3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane (PubChem CID 123224647) has the molecular formula C17H32
and a molecular weight of 236.44 g/mol. Its IUPAC name is 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane.
Molecular Properties
| Compound Name | 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane |
| PubChem CID | 123224647 |
| Molecular Formula | C17H32 |
| Molecular Weight | 236.44 g/mol |
| Exact Mass | 236.25 |
| IUPAC Name | 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane |
| SMILES | CCC1CC(C)(CC2C(C)C2C(C)C)C1(C)C |
| InChI | InChI=1S/C17H32/c1-8-13-9-17(7,16(13,5)6)10-14-12(4)15(14)11(2)3/h11-15H,8-10H2,1-7H3 |
| InChIKey | WJTZSNCHGQYXRA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 236.44 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane?
The IUPAC name of 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane (CID 123224647) is 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane.
What is the SMILES notation for 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane?
The canonical SMILES for 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane is CCC1CC(C)(CC2C(C)C2C(C)C)C1(C)C.
What is the InChIKey of 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane?
The InChIKey is WJTZSNCHGQYXRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32/c1-8-13-9-17(7,16(13,5)6)10-14-12(4)15(14)11(2)3/h11-15H,8-10H2,1-7H3.
What are the key properties of 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane?
3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane has a molecular weight of 236.44 g/mol, XLogP of 5.38, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,2,2-trimethyl-1-[(2-methyl-3-propan-2-ylcyclopropyl)methyl]cyclobutane is sourced from PubChem (CID 123224647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).