C16H26BrNOSi — CID 123224990
[(3R)-5-bromo-1,2,3,4-tetrahydroisoquinolin-3-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 123224990) has the molecular formula C16H26BrNOSi and a molecular weight of 356.38 g/mol. Its IUPAC name is [(3R)-5-bromo-1,2,3,4-tetrahydroisoquinolin-3-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R)-5-bromo-1,2,3,4-tetrahydroisoquinolin-3-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 123224990 |
| Molecular Formula | C16H26BrNOSi |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [(3R)-5-bromo-1,2,3,4-tetrahydroisoquinolin-3-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1Cc2c(Br)cccc2CN1 |
| InChI | InChI=1S/C16H26BrNOSi/c1-16(2,3)20(4,5)19-11-13-9-14-12(10-18-13)7-6-8-15(14)17/h6-8,13,18H,9-11H2,1-5H3/t13-/m1/s1 |
| InChIKey | RFDUOEZRCGXWBG-CYBMUJFWSA-N |
| XLogP | 4.49 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|