About 2-methoxy-1,5,6-trimethyl-2H-pyridine
2-methoxy-1,5,6-trimethyl-2H-pyridine (PubChem CID 123225410) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 2-methoxy-1,5,6-trimethyl-2H-pyridine.
Molecular Properties
| Compound Name | 2-methoxy-1,5,6-trimethyl-2H-pyridine |
| PubChem CID | 123225410 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 2-methoxy-1,5,6-trimethyl-2H-pyridine |
| SMILES | COC1C=CC(C)=C(C)N1C |
| InChI | InChI=1S/C9H15NO/c1-7-5-6-9(11-4)10(3)8(7)2/h5-6,9H,1-4H3 |
| InChIKey | KDPPYXFMVMBDRT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methoxy-1,5,6-trimethyl-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-1,5,6-trimethyl-2H-pyridine?
The IUPAC name of 2-methoxy-1,5,6-trimethyl-2H-pyridine (CID 123225410) is 2-methoxy-1,5,6-trimethyl-2H-pyridine.
What is the SMILES notation for 2-methoxy-1,5,6-trimethyl-2H-pyridine?
The canonical SMILES for 2-methoxy-1,5,6-trimethyl-2H-pyridine is COC1C=CC(C)=C(C)N1C.
What is the InChIKey of 2-methoxy-1,5,6-trimethyl-2H-pyridine?
The InChIKey is KDPPYXFMVMBDRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-7-5-6-9(11-4)10(3)8(7)2/h5-6,9H,1-4H3.
What are the key properties of 2-methoxy-1,5,6-trimethyl-2H-pyridine?
2-methoxy-1,5,6-trimethyl-2H-pyridine has a molecular weight of 153.22 g/mol, XLogP of 1.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-1,5,6-trimethyl-2H-pyridine is sourced from PubChem (CID 123225410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).