About 1,2,3-trimethoxyhexa-1,3-diene
1,2,3-trimethoxyhexa-1,3-diene (PubChem CID 123225618) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 1,2,3-trimethoxyhexa-1,3-diene.
Molecular Properties
| Compound Name | 1,2,3-trimethoxyhexa-1,3-diene |
| PubChem CID | 123225618 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 1,2,3-trimethoxyhexa-1,3-diene |
| SMILES | CCC=C(OC)C(=COC)OC |
| InChI | InChI=1S/C9H16O3/c1-5-6-8(11-3)9(12-4)7-10-2/h6-7H,5H2,1-4H3 |
| InChIKey | YILBDCAIZZCNOL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3-trimethoxyhexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethoxyhexa-1,3-diene?
The IUPAC name of 1,2,3-trimethoxyhexa-1,3-diene (CID 123225618) is 1,2,3-trimethoxyhexa-1,3-diene.
What is the SMILES notation for 1,2,3-trimethoxyhexa-1,3-diene?
The canonical SMILES for 1,2,3-trimethoxyhexa-1,3-diene is CCC=C(OC)C(=COC)OC.
What is the InChIKey of 1,2,3-trimethoxyhexa-1,3-diene?
The InChIKey is YILBDCAIZZCNOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-5-6-8(11-3)9(12-4)7-10-2/h6-7H,5H2,1-4H3.
What are the key properties of 1,2,3-trimethoxyhexa-1,3-diene?
1,2,3-trimethoxyhexa-1,3-diene has a molecular weight of 172.22 g/mol, XLogP of 2.06, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethoxyhexa-1,3-diene is sourced from PubChem (CID 123225618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).