About 6,6-dimethyl-2,5-dihydropyran-5-ol
6,6-dimethyl-2,5-dihydropyran-5-ol (PubChem CID 123225691) has the molecular formula C7H12O2
and a molecular weight of 128.17 g/mol. Its IUPAC name is 6,6-dimethyl-2,5-dihydropyran-5-ol.
Molecular Properties
| Compound Name | 6,6-dimethyl-2,5-dihydropyran-5-ol |
| PubChem CID | 123225691 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | 6,6-dimethyl-2,5-dihydropyran-5-ol |
| SMILES | CC1(C)OCC=CC1O |
| InChI | InChI=1S/C7H12O2/c1-7(2)6(8)4-3-5-9-7/h3-4,6,8H,5H2,1-2H3 |
| InChIKey | DGBPZENSKGGXBZ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-2,5-dihydropyran-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-2,5-dihydropyran-5-ol?
The IUPAC name of 6,6-dimethyl-2,5-dihydropyran-5-ol (CID 123225691) is 6,6-dimethyl-2,5-dihydropyran-5-ol.
What is the SMILES notation for 6,6-dimethyl-2,5-dihydropyran-5-ol?
The canonical SMILES for 6,6-dimethyl-2,5-dihydropyran-5-ol is CC1(C)OCC=CC1O.
What is the InChIKey of 6,6-dimethyl-2,5-dihydropyran-5-ol?
The InChIKey is DGBPZENSKGGXBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O2/c1-7(2)6(8)4-3-5-9-7/h3-4,6,8H,5H2,1-2H3.
What are the key properties of 6,6-dimethyl-2,5-dihydropyran-5-ol?
6,6-dimethyl-2,5-dihydropyran-5-ol has a molecular weight of 128.17 g/mol, XLogP of 0.71, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-2,5-dihydropyran-5-ol is sourced from PubChem (CID 123225691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).