C11H22S — CID 123225724
2-(2,2-dimethylcycloheptyl)ethanethiol (PubChem CID 123225724) has the molecular formula C11H22S and a molecular weight of 186.36 g/mol. Its IUPAC name is 2-(2,2-dimethylcycloheptyl)ethanethiol.
| Compound Name | 2-(2,2-dimethylcycloheptyl)ethanethiol |
|---|---|
| PubChem CID | 123225724 |
| Molecular Formula | C11H22S |
| Molecular Weight | 186.36 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 2-(2,2-dimethylcycloheptyl)ethanethiol |
| SMILES | CC1(C)CCCCCC1CCS |
| InChI | InChI=1S/C11H22S/c1-11(2)8-5-3-4-6-10(11)7-9-12/h10,12H,3-9H2,1-2H3 |
| InChIKey | LXJGHJGJQVUWBL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.36 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|