C18H16FNO3S — CID 123226149
4-(3-fluorocarbazol-9-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide (PubChem CID 123226149) has the molecular formula C18H16FNO3S and a molecular weight of 345.39 g/mol. Its IUPAC name is 4-(3-fluorocarbazol-9-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide.
| Compound Name | 4-(3-fluorocarbazol-9-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide |
|---|---|
| PubChem CID | 123226149 |
| Molecular Formula | C18H16FNO3S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-(3-fluorocarbazol-9-yl)-3a,4,5,6,7,7a-hexahydrobenzo[d][1,3,2]dioxathiole 2-oxide |
| SMILES | O=S1OC2CCCC(n3c4ccccc4c4cc(F)ccc43)C2O1 |
| InChI | InChI=1S/C18H16FNO3S/c19-11-8-9-15-13(10-11)12-4-1-2-5-14(12)20(15)16-6-3-7-17-18(16)23-24(21)22-17/h1-2,4-5,8-10,16-18H,3,6-7H2 |
| InChIKey | XHEFVGFCXNJKCC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |