C22H22ClN3O2S — CID 123226476
2-chloro-N-[2-[5-(3,5-dimethyl-4-prop-2-enoxyphenyl)-1,3,4-thiadiazol-2-yl]ethyl]benzamide (PubChem CID 123226476) has the molecular formula C22H22ClN3O2S and a molecular weight of 427.96 g/mol. Its IUPAC name is 2-chloro-N-[2-[5-(3,5-dimethyl-4-prop-2-enoxyphenyl)-1,3,4-thiadiazol-2-yl]ethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[5-(3,5-dimethyl-4-prop-2-enoxyphenyl)-1,3,4-thiadiazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 123226476 |
| Molecular Formula | C22H22ClN3O2S |
| Molecular Weight | 427.96 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-chloro-N-[2-[5-(3,5-dimethyl-4-prop-2-enoxyphenyl)-1,3,4-thiadiazol-2-yl]ethyl]benzamide |
| SMILES | C=CCOc1c(C)cc(-c2nnc(CCNC(=O)c3ccccc3Cl)s2)cc1C |
| InChI | InChI=1S/C22H22ClN3O2S/c1-4-11-28-20-14(2)12-16(13-15(20)3)22-26-25-19(29-22)9-10-24-21(27)17-7-5-6-8-18(17)23/h4-8,12-13H,1,9-11H2,2-3H3,(H,24,27) |
| InChIKey | LXPOJAZYHVAMBL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.96 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|