C12H14F5N — CID 123226728
2-ethyl-5-methyl-8-(1,1,2,2,2-pentafluoroethyl)-4,5-dihydroazocine (PubChem CID 123226728) has the molecular formula C12H14F5N and a molecular weight of 267.24 g/mol. Its IUPAC name is 2-ethyl-5-methyl-8-(1,1,2,2,2-pentafluoroethyl)-4,5-dihydroazocine.
| Compound Name | 2-ethyl-5-methyl-8-(1,1,2,2,2-pentafluoroethyl)-4,5-dihydroazocine |
|---|---|
| PubChem CID | 123226728 |
| Molecular Formula | C12H14F5N |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2-ethyl-5-methyl-8-(1,1,2,2,2-pentafluoroethyl)-4,5-dihydroazocine |
| SMILES | CCC1=CCC(C)C=C/C(C(F)(F)C(F)(F)F)=N\1 |
| InChI | InChI=1S/C12H14F5N/c1-3-9-6-4-8(2)5-7-10(18-9)11(13,14)12(15,16)17/h5-8H,3-4H2,1-2H3/b7-5?,9-6?,18-10+ |
| InChIKey | ODODAQDYTUBHOT-MQZUFBIASA-N |
| XLogP | 4.51 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|