C29H38FNO8 — CID 123226825
tert-butyl N-ethyl-N-[(5S,9S,13R,14S)-11-fluoro-18-hydroxy-7,7,13,14-tetramethyl-10,16-dioxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]carbamate (PubChem CID 123226825) has the molecular formula C29H38FNO8 and a molecular weight of 547.62 g/mol. Its IUPAC name is tert-butyl N-ethyl-N-[(5S,9S,13R,14S)-11-fluoro-18-hydroxy-7,7,13,14-tetramethyl-10,16-dioxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]carbamate.
| Compound Name | tert-butyl N-ethyl-N-[(5S,9S,13R,14S)-11-fluoro-18-hydroxy-7,7,13,14-tetramethyl-10,16-dioxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]carbamate |
|---|---|
| PubChem CID | 123226825 |
| Molecular Formula | C29H38FNO8 |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.26 |
| IUPAC Name | tert-butyl N-ethyl-N-[(5S,9S,13R,14S)-11-fluoro-18-hydroxy-7,7,13,14-tetramethyl-10,16-dioxo-6,8,15-trioxatricyclo[15.4.0.05,9]henicosa-1(17),2,11,18,20-pentaen-20-yl]carbamate |
| SMILES | CCN(C(=O)OC(C)(C)C)c1cc(O)c2c(c1)C=CC[C@@H]1OC(C)(C)O[C@@H]1C(=O)C(F)=C[C@@H](C)[C@H](C)OC2=O |
| InChI | InChI=1S/C29H38FNO8/c1-9-31(27(35)39-28(4,5)6)19-14-18-11-10-12-22-25(38-29(7,8)37-22)24(33)20(30)13-16(2)17(3)36-26(34)23(18)21(32)15-19/h10-11,13-17,22,25,32H,9,12H2,1-8H3/t16-,17+,22+,25+/m1/s1 |
| InChIKey | VXNJNHTZRZBSNK-RZIZEHHRSA-N |
| XLogP | 5.69 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|