C12H22F2N2 — CID 123226842
3,3-difluoro-1-(2-piperidin-1-ylethyl)piperidine (PubChem CID 123226842) has the molecular formula C12H22F2N2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 3,3-difluoro-1-(2-piperidin-1-ylethyl)piperidine.
| Compound Name | 3,3-difluoro-1-(2-piperidin-1-ylethyl)piperidine |
|---|---|
| PubChem CID | 123226842 |
| Molecular Formula | C12H22F2N2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 3,3-difluoro-1-(2-piperidin-1-ylethyl)piperidine |
| SMILES | FC1(F)CCCN(CCN2CCCCC2)C1 |
| InChI | InChI=1S/C12H22F2N2/c13-12(14)5-4-8-16(11-12)10-9-15-6-2-1-3-7-15/h1-11H2 |
| InChIKey | UARHUUOVPBUSOC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |