C9H20O2Si2 — CID 123227097
2-(2-cyclohexylethyl)-2-methyl-1,3,2,4-dioxadisiletane (PubChem CID 123227097) has the molecular formula C9H20O2Si2 and a molecular weight of 216.43 g/mol. Its IUPAC name is 2-(2-cyclohexylethyl)-2-methyl-1,3,2,4-dioxadisiletane.
| Compound Name | 2-(2-cyclohexylethyl)-2-methyl-1,3,2,4-dioxadisiletane |
|---|---|
| PubChem CID | 123227097 |
| Molecular Formula | C9H20O2Si2 |
| Molecular Weight | 216.43 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 2-(2-cyclohexylethyl)-2-methyl-1,3,2,4-dioxadisiletane |
| SMILES | C[Si]1(CCC2CCCCC2)O[SiH2]O1 |
| InChI | InChI=1S/C9H20O2Si2/c1-13(10-12-11-13)8-7-9-5-3-2-4-6-9/h9H,2-8,12H2,1H3 |
| InChIKey | RCQVGDVKNZHWES-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|