About 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine
5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine (PubChem CID 123227701) has the molecular formula C15H26FN3
and a molecular weight of 267.39 g/mol. Its IUPAC name is 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine.
Molecular Properties
| Compound Name | 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine |
| PubChem CID | 123227701 |
| Molecular Formula | C15H26FN3 |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.21 |
| IUPAC Name | 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine |
| SMILES | CCC1C=C(N(C)C(C)C(C)(C)C)C(F)=CN=C1N |
| InChI | InChI=1S/C15H26FN3/c1-7-11-8-13(12(16)9-18-14(11)17)19(6)10(2)15(3,4)5/h8-11H,7H2,1-6H3,(H2,17,18) |
| InChIKey | YPAZBKVYMDUZBQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine?
The IUPAC name of 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine (CID 123227701) is 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine.
What is the SMILES notation for 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine?
The canonical SMILES for 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine is CCC1C=C(N(C)C(C)C(C)(C)C)C(F)=CN=C1N.
What is the InChIKey of 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine?
The InChIKey is YPAZBKVYMDUZBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26FN3/c1-7-11-8-13(12(16)9-18-14(11)17)19(6)10(2)15(3,4)5/h8-11H,7H2,1-6H3,(H2,17,18).
What are the key properties of 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine?
5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine has a molecular weight of 267.39 g/mol, XLogP of 3.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-(3,3-dimethylbutan-2-yl)-3-ethyl-6-fluoro-5-N-methyl-3H-azepine-2,5-diamine is sourced from PubChem (CID 123227701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).