C20H17F6N5O2 — CID 123227707
propan-2-yl 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1-methylpyrazol-4-yl)prop-2-enoate (PubChem CID 123227707) has the molecular formula C20H17F6N5O2 and a molecular weight of 473.38 g/mol. Its IUPAC name is propan-2-yl 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1-methylpyrazol-4-yl)prop-2-enoate.
| Compound Name | propan-2-yl 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1-methylpyrazol-4-yl)prop-2-enoate |
|---|---|
| PubChem CID | 123227707 |
| Molecular Formula | C20H17F6N5O2 |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | propan-2-yl 3-[3-[3,5-bis(trifluoromethyl)phenyl]-1,2,4-triazol-1-yl]-2-(1-methylpyrazol-4-yl)prop-2-enoate |
| SMILES | CC(C)OC(=O)C(=Cn1cnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cnn(C)c1 |
| InChI | InChI=1S/C20H17F6N5O2/c1-11(2)33-18(32)16(13-7-28-30(3)8-13)9-31-10-27-17(29-31)12-4-14(19(21,22)23)6-15(5-12)20(24,25)26/h4-11H,1-3H3 |
| InChIKey | XAQMCBWMSRZNDJ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|