C26H37N2O6S+ — CID 123227855
benzyl (4R)-1-[(2S,9R)-9-(acetylsulfanylmethyl)-10-oxoazecane-2-carbonyl]-4-hydroxy-2-methylpyrrolidin-1-ium-1-carboxylate (PubChem CID 123227855) has the molecular formula C26H37N2O6S+ and a molecular weight of 505.66 g/mol. Its IUPAC name is benzyl (4R)-1-[(2S,9R)-9-(acetylsulfanylmethyl)-10-oxoazecane-2-carbonyl]-4-hydroxy-2-methylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | benzyl (4R)-1-[(2S,9R)-9-(acetylsulfanylmethyl)-10-oxoazecane-2-carbonyl]-4-hydroxy-2-methylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 123227855 |
| Molecular Formula | C26H37N2O6S+ |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.24 |
| IUPAC Name | benzyl (4R)-1-[(2S,9R)-9-(acetylsulfanylmethyl)-10-oxoazecane-2-carbonyl]-4-hydroxy-2-methylpyrrolidin-1-ium-1-carboxylate |
| SMILES | CC(=O)SC[C@@H]1CCCCCC[C@@H](C(=O)[N+]2(C(=O)OCc3ccccc3)C[C@H](O)CC2C)NC1=O |
| InChI | InChI=1S/C26H36N2O6S/c1-18-14-22(30)15-28(18,26(33)34-16-20-10-6-5-7-11-20)25(32)23-13-9-4-3-8-12-21(24(31)27-23)17-35-19(2)29/h5-7,10-11,18,21-23,30H,3-4,8-9,12-17H2,1-2H3/p+1/t18?,21-,22+,23-,28?/m0/s1 |
| InChIKey | GQQUMFXKFBOVDF-NDCAQWFESA-O |
| XLogP | 3.55 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|