C15H28Si2 — CID 123227996
trimethyl-(3-trimethylsilyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane (PubChem CID 123227996) has the molecular formula C15H28Si2 and a molecular weight of 264.56 g/mol. Its IUPAC name is trimethyl-(3-trimethylsilyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane.
| Compound Name | trimethyl-(3-trimethylsilyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane |
|---|---|
| PubChem CID | 123227996 |
| Molecular Formula | C15H28Si2 |
| Molecular Weight | 264.56 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | trimethyl-(3-trimethylsilyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)silane |
| SMILES | C[Si](C)(C)C1CC([Si](C)(C)C)C2C=CC=CC21 |
| InChI | InChI=1S/C15H28Si2/c1-16(2,3)14-11-15(17(4,5)6)13-10-8-7-9-12(13)14/h7-10,12-15H,11H2,1-6H3 |
| InChIKey | AHHVQPQEVVVHHC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.56 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|