C18H21ClN6O — CID 123228336
[(4-chloro-1-ethylpyrazol-3-yl)amino]-(3-pyridin-4-yl-4,5,6,7-tetrahydro-1H-indazol-5-yl)methanol (PubChem CID 123228336) has the molecular formula C18H21ClN6O and a molecular weight of 372.86 g/mol. Its IUPAC name is [(4-chloro-1-ethylpyrazol-3-yl)amino]-(3-pyridin-4-yl-4,5,6,7-tetrahydro-1H-indazol-5-yl)methanol.
| Compound Name | [(4-chloro-1-ethylpyrazol-3-yl)amino]-(3-pyridin-4-yl-4,5,6,7-tetrahydro-1H-indazol-5-yl)methanol |
|---|---|
| PubChem CID | 123228336 |
| Molecular Formula | C18H21ClN6O |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [(4-chloro-1-ethylpyrazol-3-yl)amino]-(3-pyridin-4-yl-4,5,6,7-tetrahydro-1H-indazol-5-yl)methanol |
| SMILES | CCn1cc(Cl)c(NC(O)C2CCc3[nH]nc(-c4ccncc4)c3C2)n1 |
| InChI | InChI=1S/C18H21ClN6O/c1-2-25-10-14(19)17(24-25)21-18(26)12-3-4-15-13(9-12)16(23-22-15)11-5-7-20-8-6-11/h5-8,10,12,18,26H,2-4,9H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | IBRQEPDJPHNQPE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|