C18H27BO7 — CID 123228834
ethyl 2-[1,6-dihydroxy-4-(methoxymethyl)-3H-2,1-benzoxaborol-3-yl]acetate;2-methyloxolane (PubChem CID 123228834) has the molecular formula C18H27BO7 and a molecular weight of 366.22 g/mol. Its IUPAC name is ethyl 2-[1,6-dihydroxy-4-(methoxymethyl)-3H-2,1-benzoxaborol-3-yl]acetate;2-methyloxolane.
| Compound Name | ethyl 2-[1,6-dihydroxy-4-(methoxymethyl)-3H-2,1-benzoxaborol-3-yl]acetate;2-methyloxolane |
|---|---|
| PubChem CID | 123228834 |
| Molecular Formula | C18H27BO7 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | ethyl 2-[1,6-dihydroxy-4-(methoxymethyl)-3H-2,1-benzoxaborol-3-yl]acetate;2-methyloxolane |
| SMILES | CC1CCCO1.CCOC(=O)CC1OB(O)c2cc(O)cc(COC)c21 |
| InChI | InChI=1S/C13H17BO6.C5H10O/c1-3-19-12(16)6-11-13-8(7-18-2)4-9(15)5-10(13)14(17)20-11;1-5-3-2-4-6-5/h4-5,11,15,17H,3,6-7H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | XSTSMVSKSOMFMU-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|