C17H15Cl2NO2 — CID 123228941
N-[1-(3-acetylphenyl)ethyl]-2,6-dichlorobenzamide (PubChem CID 123228941) has the molecular formula C17H15Cl2NO2 and a molecular weight of 336.22 g/mol. Its IUPAC name is N-[1-(3-acetylphenyl)ethyl]-2,6-dichlorobenzamide.
| Compound Name | N-[1-(3-acetylphenyl)ethyl]-2,6-dichlorobenzamide |
|---|---|
| PubChem CID | 123228941 |
| Molecular Formula | C17H15Cl2NO2 |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[1-(3-acetylphenyl)ethyl]-2,6-dichlorobenzamide |
| SMILES | CC(=O)c1cccc(C(C)NC(=O)c2c(Cl)cccc2Cl)c1 |
| InChI | InChI=1S/C17H15Cl2NO2/c1-10(12-5-3-6-13(9-12)11(2)21)20-17(22)16-14(18)7-4-8-15(16)19/h3-10H,1-2H3,(H,20,22) |
| InChIKey | AUHGBQVQZXLJBR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |