About 2-cyclohex-2-en-1-yl-N,N-diethylacetamide
2-cyclohex-2-en-1-yl-N,N-diethylacetamide (PubChem CID 123229557) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-cyclohex-2-en-1-yl-N,N-diethylacetamide.
Molecular Properties
| Compound Name | 2-cyclohex-2-en-1-yl-N,N-diethylacetamide |
| PubChem CID | 123229557 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-cyclohex-2-en-1-yl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CC1C=CCCC1 |
| InChI | InChI=1S/C12H21NO/c1-3-13(4-2)12(14)10-11-8-6-5-7-9-11/h6,8,11H,3-5,7,9-10H2,1-2H3 |
| InChIKey | GZHJXONWDMHSLS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohex-2-en-1-yl-N,N-diethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohex-2-en-1-yl-N,N-diethylacetamide?
The IUPAC name of 2-cyclohex-2-en-1-yl-N,N-diethylacetamide (CID 123229557) is 2-cyclohex-2-en-1-yl-N,N-diethylacetamide.
What is the SMILES notation for 2-cyclohex-2-en-1-yl-N,N-diethylacetamide?
The canonical SMILES for 2-cyclohex-2-en-1-yl-N,N-diethylacetamide is CCN(CC)C(=O)CC1C=CCCC1.
What is the InChIKey of 2-cyclohex-2-en-1-yl-N,N-diethylacetamide?
The InChIKey is GZHJXONWDMHSLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-3-13(4-2)12(14)10-11-8-6-5-7-9-11/h6,8,11H,3-5,7,9-10H2,1-2H3.
What are the key properties of 2-cyclohex-2-en-1-yl-N,N-diethylacetamide?
2-cyclohex-2-en-1-yl-N,N-diethylacetamide has a molecular weight of 195.31 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohex-2-en-1-yl-N,N-diethylacetamide is sourced from PubChem (CID 123229557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).