C30H45NO3 — CID 123229676
(8S,13R,14S,17R)-17-[2-[2-[4-(dimethylamino)phenyl]ethoxy]ethyl]-13-methyl-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3-diol (PubChem CID 123229676) has the molecular formula C30H45NO3 and a molecular weight of 467.69 g/mol. Its IUPAC name is (8S,13R,14S,17R)-17-[2-[2-[4-(dimethylamino)phenyl]ethoxy]ethyl]-13-methyl-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3-diol.
| Compound Name | (8S,13R,14S,17R)-17-[2-[2-[4-(dimethylamino)phenyl]ethoxy]ethyl]-13-methyl-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3-diol |
|---|---|
| PubChem CID | 123229676 |
| Molecular Formula | C30H45NO3 |
| Molecular Weight | 467.69 g/mol |
| Exact Mass | 467.34 |
| IUPAC Name | (8S,13R,14S,17R)-17-[2-[2-[4-(dimethylamino)phenyl]ethoxy]ethyl]-13-methyl-2,4,5,6,7,8,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,3-diol |
| SMILES | CN(C)c1ccc(CCOCC[C@H]2CC[C@H]3[C@@H]4CCC5CC(O)(O)CCC5=C4CC[C@]23C)cc1 |
| InChI | InChI=1S/C30H45NO3/c1-29-16-12-26-25-13-17-30(32,33)20-22(25)6-10-27(26)28(29)11-7-23(29)15-19-34-18-14-21-4-8-24(9-5-21)31(2)3/h4-5,8-9,22-23,27-28,32-33H,6-7,10-20H2,1-3H3/t22?,23-,27-,28+,29-/m1/s1 |
| InChIKey | JEIYRQQMVPDNMF-KLKPJVRHSA-N |
| XLogP | 5.72 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.69 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|