About methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate
methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate (PubChem CID 123229785) has the molecular formula C19H24O6
and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate.
Molecular Properties
| Compound Name | methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate |
| PubChem CID | 123229785 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate |
| SMILES | COC(=O)C(C)=CCCC(C)=CCOC(=O)Cc1oc(=O)ccc1C |
| InChI | InChI=1S/C19H24O6/c1-13(6-5-7-15(3)19(22)23-4)10-11-24-18(21)12-16-14(2)8-9-17(20)25-16/h7-10H,5-6,11-12H2,1-4H3 |
| InChIKey | DTGSLKMCMZZUGV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate?
The IUPAC name of methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate (CID 123229785) is methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate.
What is the SMILES notation for methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate?
The canonical SMILES for methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate is COC(=O)C(C)=CCCC(C)=CCOC(=O)Cc1oc(=O)ccc1C.
What is the InChIKey of methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate?
The InChIKey is DTGSLKMCMZZUGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O6/c1-13(6-5-7-15(3)19(22)23-4)10-11-24-18(21)12-16-14(2)8-9-17(20)25-16/h7-10H,5-6,11-12H2,1-4H3.
What are the key properties of methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate?
methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate has a molecular weight of 348.40 g/mol, XLogP of 2.88, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,6-dimethyl-8-[2-(3-methyl-6-oxopyran-2-yl)acetyl]oxyocta-2,6-dienoate is sourced from PubChem (CID 123229785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).