C16H24N4O — CID 123229958
6-[2-(methylamino)propylamino]-3-[[(3Z)-5-methylhexa-3,5-dien-2-ylidene]amino]-1H-pyridin-2-one (PubChem CID 123229958) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is 6-[2-(methylamino)propylamino]-3-[[(3Z)-5-methylhexa-3,5-dien-2-ylidene]amino]-1H-pyridin-2-one.
| Compound Name | 6-[2-(methylamino)propylamino]-3-[[(3Z)-5-methylhexa-3,5-dien-2-ylidene]amino]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 123229958 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 6-[2-(methylamino)propylamino]-3-[[(3Z)-5-methylhexa-3,5-dien-2-ylidene]amino]-1H-pyridin-2-one |
| SMILES | C=C(C)/C=C\C(C)=N\c1ccc(NCC(C)NC)[nH]c1=O |
| InChI | InChI=1S/C16H24N4O/c1-11(2)6-7-12(3)19-14-8-9-15(20-16(14)21)18-10-13(4)17-5/h6-9,13,17H,1,10H2,2-5H3,(H2,18,20,21)/b7-6-,19-12+ |
| InChIKey | GKKKHRFWFKUIQD-FVKKEFOGSA-N |
| XLogP | 2.62 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|