C24H23FO6 — CID 123230134
[(2R,3R,4S)-4-fluoro-5-methoxy-3-(3-phenylprop-2-enoyloxy)oxolan-2-yl]methyl 3-phenylprop-2-enoate (PubChem CID 123230134) has the molecular formula C24H23FO6 and a molecular weight of 426.44 g/mol. Its IUPAC name is [(2R,3R,4S)-4-fluoro-5-methoxy-3-(3-phenylprop-2-enoyloxy)oxolan-2-yl]methyl 3-phenylprop-2-enoate.
| Compound Name | [(2R,3R,4S)-4-fluoro-5-methoxy-3-(3-phenylprop-2-enoyloxy)oxolan-2-yl]methyl 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 123230134 |
| Molecular Formula | C24H23FO6 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | [(2R,3R,4S)-4-fluoro-5-methoxy-3-(3-phenylprop-2-enoyloxy)oxolan-2-yl]methyl 3-phenylprop-2-enoate |
| SMILES | COC1O[C@H](COC(=O)C=Cc2ccccc2)[C@@H](OC(=O)C=Cc2ccccc2)[C@@H]1F |
| InChI | InChI=1S/C24H23FO6/c1-28-24-22(25)23(31-21(27)15-13-18-10-6-3-7-11-18)19(30-24)16-29-20(26)14-12-17-8-4-2-5-9-17/h2-15,19,22-24H,16H2,1H3/t19-,22+,23-,24?/m1/s1 |
| InChIKey | LKXWQYMBCAJHHV-QDLHARERSA-N |
| XLogP | 3.58 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|