About 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one
3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one (PubChem CID 123230177) has the molecular formula C15H19N3O
and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one |
| PubChem CID | 123230177 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one |
| SMILES | CCCC1CCN(Cc2c[nH]c3cnccc23)C1=O |
| InChI | InChI=1S/C15H19N3O/c1-2-3-11-5-7-18(15(11)19)10-12-8-17-14-9-16-6-4-13(12)14/h4,6,8-9,11,17H,2-3,5,7,10H2,1H3 |
| InChIKey | GPRBWLKDWVYIHH-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one?
The IUPAC name of 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one (CID 123230177) is 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one.
What is the SMILES notation for 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one?
The canonical SMILES for 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one is CCCC1CCN(Cc2c[nH]c3cnccc23)C1=O.
What is the InChIKey of 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one?
The InChIKey is GPRBWLKDWVYIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O/c1-2-3-11-5-7-18(15(11)19)10-12-8-17-14-9-16-6-4-13(12)14/h4,6,8-9,11,17H,2-3,5,7,10H2,1H3.
What are the key properties of 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one?
3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one has a molecular weight of 257.34 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1-(1H-pyrrolo[2,3-c]pyridin-3-ylmethyl)pyrrolidin-2-one is sourced from PubChem (CID 123230177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).