C25H30N4O2 — CID 123230199
methyl N-[1-[1-(2-aminoethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]-3-cyano-4-propan-2-yloxybenzenecarboximidate (PubChem CID 123230199) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is methyl N-[1-[1-(2-aminoethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]-3-cyano-4-propan-2-yloxybenzenecarboximidate.
| Compound Name | methyl N-[1-[1-(2-aminoethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]-3-cyano-4-propan-2-yloxybenzenecarboximidate |
|---|---|
| PubChem CID | 123230199 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | methyl N-[1-[1-(2-aminoethylamino)-2,3-dihydro-1H-inden-4-yl]ethenyl]-3-cyano-4-propan-2-yloxybenzenecarboximidate |
| SMILES | C=C(/N=C(\OC)c1ccc(OC(C)C)c(C#N)c1)c1cccc2c1CCC2NCCN |
| InChI | InChI=1S/C25H30N4O2/c1-16(2)31-24-11-8-18(14-19(24)15-27)25(30-4)29-17(3)20-6-5-7-22-21(20)9-10-23(22)28-13-12-26/h5-8,11,14,16,23,28H,3,9-10,12-13,26H2,1-2,4H3/b29-25- |
| InChIKey | AMFPEAOYJQPKNR-GNVQSUKOSA-N |
| XLogP | 3.94 |
| TPSA | 92.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|