C10H17F3OSi — CID 123230651
ethenyl-(oxan-2-yl)-(3,3,3-trifluoropropyl)silane (PubChem CID 123230651) has the molecular formula C10H17F3OSi and a molecular weight of 238.32 g/mol. Its IUPAC name is ethenyl-(oxan-2-yl)-(3,3,3-trifluoropropyl)silane.
| Compound Name | ethenyl-(oxan-2-yl)-(3,3,3-trifluoropropyl)silane |
|---|---|
| PubChem CID | 123230651 |
| Molecular Formula | C10H17F3OSi |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | ethenyl-(oxan-2-yl)-(3,3,3-trifluoropropyl)silane |
| SMILES | C=C[SiH](CCC(F)(F)F)C1CCCCO1 |
| InChI | InChI=1S/C10H17F3OSi/c1-2-15(8-6-10(11,12)13)9-5-3-4-7-14-9/h2,9,15H,1,3-8H2 |
| InChIKey | NARXLJJEJIIIQY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|