About 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide
4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide (PubChem CID 123231332) has the molecular formula C8H16F2N2O3
and a molecular weight of 226.22 g/mol. Its IUPAC name is 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide.
Molecular Properties
| Compound Name | 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide |
| PubChem CID | 123231332 |
| Molecular Formula | C8H16F2N2O3 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide |
| SMILES | CC(O)C(C)NC(=O)C(O)C(F)(F)CN |
| InChI | InChI=1S/C8H16F2N2O3/c1-4(5(2)13)12-7(15)6(14)8(9,10)3-11/h4-6,13-14H,3,11H2,1-2H3,(H,12,15) |
| InChIKey | JVAFNEMGRWGIBL-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide?
The IUPAC name of 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide (CID 123231332) is 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide.
What is the SMILES notation for 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide?
The canonical SMILES for 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide is CC(O)C(C)NC(=O)C(O)C(F)(F)CN.
What is the InChIKey of 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide?
The InChIKey is JVAFNEMGRWGIBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16F2N2O3/c1-4(5(2)13)12-7(15)6(14)8(9,10)3-11/h4-6,13-14H,3,11H2,1-2H3,(H,12,15).
What are the key properties of 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide?
4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide has a molecular weight of 226.22 g/mol, XLogP of -1.17, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3,3-difluoro-2-hydroxy-N-(3-hydroxybutan-2-yl)butanamide is sourced from PubChem (CID 123231332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).