About 3,3-dimethyl-4,5-dihydroindole
3,3-dimethyl-4,5-dihydroindole (PubChem CID 123231392) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 3,3-dimethyl-4,5-dihydroindole.
Molecular Properties
| Compound Name | 3,3-dimethyl-4,5-dihydroindole |
| PubChem CID | 123231392 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 3,3-dimethyl-4,5-dihydroindole |
| SMILES | CC1(C)C=NC2=C1CCC=C2 |
| InChI | InChI=1S/C10H13N/c1-10(2)7-11-9-6-4-3-5-8(9)10/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | QSWXMVKUEUJQBB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-dimethyl-4,5-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-4,5-dihydroindole?
The IUPAC name of 3,3-dimethyl-4,5-dihydroindole (CID 123231392) is 3,3-dimethyl-4,5-dihydroindole.
What is the SMILES notation for 3,3-dimethyl-4,5-dihydroindole?
The canonical SMILES for 3,3-dimethyl-4,5-dihydroindole is CC1(C)C=NC2=C1CCC=C2.
What is the InChIKey of 3,3-dimethyl-4,5-dihydroindole?
The InChIKey is QSWXMVKUEUJQBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-10(2)7-11-9-6-4-3-5-8(9)10/h4,6-7H,3,5H2,1-2H3.
What are the key properties of 3,3-dimethyl-4,5-dihydroindole?
3,3-dimethyl-4,5-dihydroindole has a molecular weight of 147.22 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-4,5-dihydroindole is sourced from PubChem (CID 123231392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).