C20H21N5O2 — CID 123231603
1-[3-[(2-hydroxy-1-phenylethyl)amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]prop-2-en-1-one (PubChem CID 123231603) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 1-[3-[(2-hydroxy-1-phenylethyl)amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[(2-hydroxy-1-phenylethyl)amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 123231603 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 1-[3-[(2-hydroxy-1-phenylethyl)amino]-4,6,7,11-tetrazatricyclo[7.4.0.02,7]trideca-1,3,5,8-tetraen-11-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCc2c(cn3ncnc(NC(CO)c4ccccc4)c23)C1 |
| InChI | InChI=1S/C20H21N5O2/c1-2-18(27)24-9-8-16-15(10-24)11-25-19(16)20(21-13-22-25)23-17(12-26)14-6-4-3-5-7-14/h2-7,11,13,17,26H,1,8-10,12H2,(H,21,22,23) |
| InChIKey | IREOUZFOMJAIDI-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|