C40H39N3 — CID 123231652
2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-6-spiro[1,5,6,9a-tetrahydrofluorene-9,9'-3,4,8,8a-tetrahydrofluorene]-2'-yl-1,4-dihydro-1,3,5-triazine (PubChem CID 123231652) has the molecular formula C40H39N3 and a molecular weight of 561.77 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-6-spiro[1,5,6,9a-tetrahydrofluorene-9,9'-3,4,8,8a-tetrahydrofluorene]-2'-yl-1,4-dihydro-1,3,5-triazine.
| Compound Name | 2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-6-spiro[1,5,6,9a-tetrahydrofluorene-9,9'-3,4,8,8a-tetrahydrofluorene]-2'-yl-1,4-dihydro-1,3,5-triazine |
|---|---|
| PubChem CID | 123231652 |
| Molecular Formula | C40H39N3 |
| Molecular Weight | 561.77 g/mol |
| Exact Mass | 561.31 |
| IUPAC Name | 2-cyclohexa-1,5-dien-1-yl-4-cyclohexa-2,4-dien-1-yl-6-spiro[1,5,6,9a-tetrahydrofluorene-9,9'-3,4,8,8a-tetrahydrofluorene]-2'-yl-1,4-dihydro-1,3,5-triazine |
| SMILES | C1=CCC(C2N=C(C3=CCCC=C3)NC(C3=CC4=C(CC3)C3=CC=CCC3C43C4=C(CCC=C4)C4=CC=CCC43)=N2)C=C1 |
| InChI | InChI=1S/C40H39N3/c1-3-13-26(14-4-1)37-41-38(27-15-5-2-6-16-27)43-39(42-37)28-23-24-32-31-19-9-12-22-35(31)40(36(32)25-28)33-20-10-7-17-29(33)30-18-8-11-21-34(30)40/h1,3-5,7,9-13,15-17,19,21,25-26,33,35,37H,2,6,8,14,18,20,22-24H2,(H,41,42,43) |
| InChIKey | SNHGCHDETGTBMO-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.77 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |