C19H23FN4O2 — CID 123231827
(1R,2S,3R,5R)-3-[[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrimidin-4-yl]amino]-5-methylcyclopentane-1,2-diol (PubChem CID 123231827) has the molecular formula C19H23FN4O2 and a molecular weight of 358.42 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrimidin-4-yl]amino]-5-methylcyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrimidin-4-yl]amino]-5-methylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 123231827 |
| Molecular Formula | C19H23FN4O2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-[[(1S)-2,3-dihydro-1H-inden-1-yl]amino]-5-fluoropyrimidin-4-yl]amino]-5-methylcyclopentane-1,2-diol |
| SMILES | C[C@@H]1C[C@@H](Nc2nc(N[C@H]3CCc4ccccc43)ncc2F)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H23FN4O2/c1-10-8-15(17(26)16(10)25)22-18-13(20)9-21-19(24-18)23-14-7-6-11-4-2-3-5-12(11)14/h2-5,9-10,14-17,25-26H,6-8H2,1H3,(H2,21,22,23,24)/t10-,14+,15-,16-,17+/m1/s1 |
| InChIKey | OHHSIAFYILFUBX-XHLKGYDDSA-N |
| XLogP | 2.26 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |