C23H22N4O4S2 — CID 123231857
N-[3-[5-[3-(cyclobutylcarbamoyl)-1,2-oxazol-5-yl]thiophen-3-yl]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide (PubChem CID 123231857) has the molecular formula C23H22N4O4S2 and a molecular weight of 482.59 g/mol. Its IUPAC name is N-[3-[5-[3-(cyclobutylcarbamoyl)-1,2-oxazol-5-yl]thiophen-3-yl]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[3-[5-[3-(cyclobutylcarbamoyl)-1,2-oxazol-5-yl]thiophen-3-yl]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 123231857 |
| Molecular Formula | C23H22N4O4S2 |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | N-[3-[5-[3-(cyclobutylcarbamoyl)-1,2-oxazol-5-yl]thiophen-3-yl]propyl]-5-thiophen-2-yl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCCc1csc(-c2cc(C(=O)NC3CCC3)no2)c1)c1cc(-c2cccs2)on1 |
| InChI | InChI=1S/C23H22N4O4S2/c28-22(16-11-18(30-26-16)20-7-3-9-32-20)24-8-2-4-14-10-21(33-13-14)19-12-17(27-31-19)23(29)25-15-5-1-6-15/h3,7,9-13,15H,1-2,4-6,8H2,(H,24,28)(H,25,29) |
| InChIKey | UNBVVXVCFJZILI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|