About 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene
7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene (PubChem CID 123232045) has the molecular formula C13H14
and a molecular weight of 170.25 g/mol. Its IUPAC name is 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene.
Molecular Properties
| Compound Name | 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene |
| PubChem CID | 123232045 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene |
| SMILES | CC1=C(C2=CCC2)C2=C1C1CCC21 |
| InChI | InChI=1S/C13H14/c1-7-11(8-3-2-4-8)13-10-6-5-9(10)12(7)13/h3,9-10H,2,4-6H2,1H3 |
| InChIKey | UOLCSGPPELZPGK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene?
The IUPAC name of 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene (CID 123232045) is 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene.
What is the SMILES notation for 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene?
The canonical SMILES for 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene is CC1=C(C2=CCC2)C2=C1C1CCC21.
What is the InChIKey of 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene?
The InChIKey is UOLCSGPPELZPGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14/c1-7-11(8-3-2-4-8)13-10-6-5-9(10)12(7)13/h3,9-10H,2,4-6H2,1H3.
What are the key properties of 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene?
7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene has a molecular weight of 170.25 g/mol, XLogP of 3.37, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(cyclobuten-1-yl)-8-methyltricyclo[4.2.0.02,5]octa-1(6),7-diene is sourced from PubChem (CID 123232045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).