About aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol
aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol (PubChem CID 123232130) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol.
Molecular Properties
| Compound Name | aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol |
| PubChem CID | 123232130 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol |
| SMILES | CC1=CCCC(C)C1C(O)N1CC1 |
| InChI | InChI=1S/C11H19NO/c1-8-4-3-5-9(2)10(8)11(13)12-6-7-12/h4,9-11,13H,3,5-7H2,1-2H3 |
| InChIKey | LHUZDDLKAOBTHU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol?
The IUPAC name of aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol (CID 123232130) is aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol.
What is the SMILES notation for aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol?
The canonical SMILES for aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol is CC1=CCCC(C)C1C(O)N1CC1.
What is the InChIKey of aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol?
The InChIKey is LHUZDDLKAOBTHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-8-4-3-5-9(2)10(8)11(13)12-6-7-12/h4,9-11,13H,3,5-7H2,1-2H3.
What are the key properties of aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol?
aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol has a molecular weight of 181.28 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aziridin-1-yl-(2,6-dimethylcyclohex-2-en-1-yl)methanol is sourced from PubChem (CID 123232130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).